 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCC)C(=O)[O-] |
| InChI: | InChI=1/C23H28N2O5/c1-2-3-14-19(22(27)28)24-21(26)20(15-17-10-6-4-7-11-17)25-23(29)30-16-18-12-8-5-9-13-18/h4-13,19-20H,2-3,14-16H2,1H3,(H,24,26)(H,25,29)(H,27,28)/p-1/t19-,20+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=52.6026 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 411.478 g/mol | logS: -5.42548 | SlogP: 2.21537 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.174407 | Sterimol/B1: 2.25547 | Sterimol/B2: 3.47113 | Sterimol/B3: 8.5442 | |||
| Sterimol/B4: 8.93211 | Sterimol/L: 16.931 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 730.561 | Positive charged surface: 438.302 | Negative charged surface: 292.259 | Volume: 409.875 | |||
| Hydrophobic surface: 548.956 | Hydrophilic surface: 181.605 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
