 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(SCC([NH3+])C(=O)NC(C(=O)[O-])C)CC(N)C(=O)NC(C(=O)[O-])C |
| InChI: | InChI=1/C12H22N4O6S2/c1-5(11(19)20)15-9(17)7(13)3-23-24-4-8(14)10(18)16-6(2)12(21)22/h5-8H,3-4,13-14H2,1-2H3,(H,15,17)(H,16,18)(H,19,20)(H,21,22)/p-1/t5-,6+,7-,8+ |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=62.1207 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 381.454 g/mol | logS: -2.55669 | SlogP: -5.1852 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.0821767 | Sterimol/B1: 3.49366 | Sterimol/B2: 3.67396 | Sterimol/B3: 4.55099 | |||
| Sterimol/B4: 7.4738 | Sterimol/L: 16.0487 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 623.342 | Positive charged surface: 339.683 | Negative charged surface: 283.659 | Volume: 325.125 | |||
| Hydrophobic surface: 203.735 | Hydrophilic surface: 419.607 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 4 | Basic groups: 1 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
