Type: Neutral
Formula: C11H15N2O6PS
SMILES: |
S=P1(OC2CC(OC2CO1)N1C=C(C)C(=O)NC1=O)OC |
InChI: |
InChI=1/C11H15N2O6PS/c1-6-4-13(11(15)12-10(6)14)9-3-7-8(18-9)5-17-20(21,16-2)19-7/h4,7-9H,3,5H2,1-2H3,(H,12,14,15)/t7-,8-,9-,20+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 334.289 g/mol | logS: -2.37551 | SlogP: 0.8433 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.205578 | Sterimol/B1: 2.26546 | Sterimol/B2: 3.0554 | Sterimol/B3: 4.22583 |
Sterimol/B4: 7.74986 | Sterimol/L: 12.4991 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 475.618 | Positive charged surface: 322.007 | Negative charged surface: 153.611 | Volume: 267.125 |
Hydrophobic surface: 296.672 | Hydrophilic surface: 178.946 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |