Type: Neutral
Formula: C12H20N4O5
SMILES: |
O1C(CO)C(O)C(O)C(N(C)C)C1N1C=CC(=NC1=O)N |
InChI: |
InChI=1/C12H20N4O5/c1-15(2)8-10(19)9(18)6(5-17)21-11(8)16-4-3-7(13)14-12(16)20/h3-4,6,8-11,17-19H,5H2,1-2H3,(H2,13,14,20)/t6-,8-,9+,10-,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 300.315 g/mol | logS: 0.0297 | SlogP: -2.3379 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.197837 | Sterimol/B1: 2.80952 | Sterimol/B2: 2.81825 | Sterimol/B3: 4.90828 |
Sterimol/B4: 8.47129 | Sterimol/L: 12.7571 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 499.164 | Positive charged surface: 383.191 | Negative charged surface: 115.973 | Volume: 264 |
Hydrophobic surface: 247.034 | Hydrophilic surface: 252.13 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |