Type: Neutral
Formula: C10H14N2O7
SMILES: |
O1C(CO)C(O)C(O)C(O)C1N1C=CC(=O)NC1=O |
InChI: |
InChI=1/C10H14N2O7/c13-3-4-6(15)7(16)8(17)9(19-4)12-2-1-5(14)11-10(12)18/h1-2,4,6-9,13,15-17H,3H2,(H,11,14,18)/t4-,6+,7+,8-,9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 274.229 g/mol | logS: 0.33089 | SlogP: -3.1482 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.180938 | Sterimol/B1: 2.51266 | Sterimol/B2: 4.79097 | Sterimol/B3: 5.26825 |
Sterimol/B4: 5.49302 | Sterimol/L: 12.4072 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 450.687 | Positive charged surface: 298.809 | Negative charged surface: 151.878 | Volume: 220.25 |
Hydrophobic surface: 161.087 | Hydrophilic surface: 289.6 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |