Type: Neutral
Formula: C10H15N3O6
SMILES: |
O1C(CO)C(O)C(O)C(N)C1N1C=CC(=O)NC1=O |
InChI: |
InChI=1/C10H15N3O6/c11-6-8(17)7(16)4(3-14)19-9(6)13-2-1-5(15)12-10(13)18/h1-2,4,6-9,14,16-17H,3,11H2,(H,12,15,18)/t4-,6-,7+,8-,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 273.245 g/mol | logS: 0.43699 | SlogP: -3.1818 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.252791 | Sterimol/B1: 2.29475 | Sterimol/B2: 4.67773 | Sterimol/B3: 4.89166 |
Sterimol/B4: 5.10905 | Sterimol/L: 11.1048 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 428.909 | Positive charged surface: 295.659 | Negative charged surface: 133.25 | Volume: 221.375 |
Hydrophobic surface: 140.075 | Hydrophilic surface: 288.834 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |