Type: Neutral
Formula: C17H28N4O4S3
SMILES: |
S(CCC(NC(=O)C(NS(=O)(=O)Cc1ccccc1)CCSC)C(=O)NN)C |
InChI: |
InChI=1/C17H28N4O4S3/c1-26-10-8-14(17(23)20-18)19-16(22)15(9-11-27-2)21-28(24,25)12-13-6-4-3-5-7-13/h3-7,14-15,21H,8-12,18H2,1-2H3,(H,19,22)(H,20,23)/t14-,15+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 448.633 g/mol | logS: -3.98526 | SlogP: 0.7219 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0597911 | Sterimol/B1: 3.21883 | Sterimol/B2: 4.71616 | Sterimol/B3: 5.77675 |
Sterimol/B4: 9.55158 | Sterimol/L: 18.4717 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 742.236 | Positive charged surface: 421.783 | Negative charged surface: 320.453 | Volume: 405.75 |
Hydrophobic surface: 452.409 | Hydrophilic surface: 289.827 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |