Type: Neutral
Formula: C18H33N3O5
SMILES: |
O(C(C)(C)C)C(=O)NC1CC(NC(=O)C)CCC1NC(OC(C)(C)C)=O |
InChI: |
InChI=1/C18H33N3O5/c1-11(22)19-12-8-9-13(20-15(23)25-17(2,3)4)14(10-12)21-16(24)26-18(5,6)7/h12-14H,8-10H2,1-7H3,(H,19,22)(H,20,23)(H,21,24)/t12-,13-,14+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 371.478 g/mol | logS: -2.98666 | SlogP: 2.4616 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0840726 | Sterimol/B1: 2.34002 | Sterimol/B2: 3.37203 | Sterimol/B3: 3.81193 |
Sterimol/B4: 11.604 | Sterimol/L: 15.398 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 684.62 | Positive charged surface: 478.85 | Negative charged surface: 205.769 | Volume: 372.5 |
Hydrophobic surface: 468.286 | Hydrophilic surface: 216.334 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |