Type: Neutral
Formula: C17H20N2O5S
SMILES: |
S(CC1=CN(C2OC(CO)C(O)C2)C(=O)NC1=O)c1ccc(cc1)C |
InChI: |
InChI=1/C17H20N2O5S/c1-10-2-4-12(5-3-10)25-9-11-7-19(17(23)18-16(11)22)15-6-13(21)14(8-20)24-15/h2-5,7,13-15,20-21H,6,8-9H2,1H3,(H,18,22,23)/t13-,14+,15+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 364.422 g/mol | logS: -3.57521 | SlogP: 0.99102 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0431936 | Sterimol/B1: 2.92132 | Sterimol/B2: 4.33075 | Sterimol/B3: 4.52611 |
Sterimol/B4: 7.20165 | Sterimol/L: 18.077 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 618.694 | Positive charged surface: 383.559 | Negative charged surface: 235.135 | Volume: 324.375 |
Hydrophobic surface: 373.831 | Hydrophilic surface: 244.863 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |