Type: Neutral
Formula: C15H22N2O6
SMILES: |
O1C(COC(=O)C(C)(C)C)C(O)CC1N1C=C(C)C(=O)NC1=O |
InChI: |
InChI=1/C15H22N2O6/c1-8-6-17(14(21)16-12(8)19)11-5-9(18)10(23-11)7-22-13(20)15(2,3)4/h6,9-11,18H,5,7H2,1-4H3,(H,16,19,21)/t9-,10-,11+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 326.349 g/mol | logS: -1.51629 | SlogP: 0.5072 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0850346 | Sterimol/B1: 2.42276 | Sterimol/B2: 2.6844 | Sterimol/B3: 4.41043 |
Sterimol/B4: 9.06519 | Sterimol/L: 14.8316 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 559.425 | Positive charged surface: 367.645 | Negative charged surface: 191.78 | Volume: 297.875 |
Hydrophobic surface: 314.142 | Hydrophilic surface: 245.283 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |