 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(CC([NH3+])C(=O)[O-])CNc1ncnc2n(cnc12)C1OC(CO)C(O)C1[O-] |
| InChI: | InChI=1/C14H19N6O6S/c15-6(14(24)25)2-27-5-19-11-8-12(17-3-16-11)20(4-18-8)13-10(23)9(22)7(1-21)26-13/h3-4,6-7,9-10,13,21-22H,1-2,5,15H2,(H,24,25)(H,16,17,19)/q-1/t6-,7-,9+,10+,13-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=51.9031 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 399.408 g/mol | logS: -1.73042 | SlogP: -3.5655 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0363734 | Sterimol/B1: 2.47046 | Sterimol/B2: 2.82246 | Sterimol/B3: 4.99227 | |||
| Sterimol/B4: 8.12192 | Sterimol/L: 18.797 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 629.157 | Positive charged surface: 424.277 | Negative charged surface: 204.88 | Volume: 332.125 | |||
| Hydrophobic surface: 248.907 | Hydrophilic surface: 380.25 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 3 | Basic groups: 1 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
