Type: Neutral
Formula: C16H24O8
SMILES: |
O1C(C)C(O)C(O)C(O)C1OC1OC=C(C=O)C2(O)C1C(CC2)C |
InChI: |
InChI=1/C16H24O8/c1-7-3-4-16(21)9(5-17)6-22-14(10(7)16)24-15-13(20)12(19)11(18)8(2)23-15/h5-8,10-15,18-21H,3-4H2,1-2H3/t7-,8-,10-,11+,12+,13+,14-,15-,16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 344.36 g/mol | logS: -1.13328 | SlogP: -0.9532 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.144086 | Sterimol/B1: 2.0553 | Sterimol/B2: 3.61355 | Sterimol/B3: 3.98847 |
Sterimol/B4: 7.84133 | Sterimol/L: 12.8336 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 530.388 | Positive charged surface: 379.828 | Negative charged surface: 150.56 | Volume: 306.375 |
Hydrophobic surface: 284.987 | Hydrophilic surface: 245.401 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 9 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |