Type: Neutral
Formula: C15H22N2O3
SMILES: |
OC(=O)C(NC(=O)C(N)C(CC)C)Cc1ccccc1 |
InChI: |
InChI=1/C15H22N2O3/c1-3-10(2)13(16)14(18)17-12(15(19)20)9-11-7-5-4-6-8-11/h4-8,10,12-13H,3,9,16H2,1-2H3,(H,17,18)(H,19,20)/t10-,12+,13-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 278.352 g/mol | logS: -2.52565 | SlogP: 1.17187 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.123502 | Sterimol/B1: 3.34717 | Sterimol/B2: 3.40914 | Sterimol/B3: 4.82324 |
Sterimol/B4: 6.56873 | Sterimol/L: 12.4798 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 498.741 | Positive charged surface: 314.919 | Negative charged surface: 183.821 | Volume: 276 |
Hydrophobic surface: 306.989 | Hydrophilic surface: 191.752 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |