Type: Neutral
Formula: C10H14N2O8S
SMILES: |
S(OCC1OC(N2C=CC(=O)NC2=O)C(O)C1O)(=O)(=O)C |
InChI: |
InChI=1/C10H14N2O8S/c1-21(17,18)19-4-5-7(14)8(15)9(20-5)12-3-2-6(13)11-10(12)16/h2-3,5,7-9,14-15H,4H2,1H3,(H,11,13,16)/t5-,7-,8+,9-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 322.294 g/mol | logS: -0.43992 | SlogP: -2.5252 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.134738 | Sterimol/B1: 2.1805 | Sterimol/B2: 3.23739 | Sterimol/B3: 4.1571 |
Sterimol/B4: 7.68314 | Sterimol/L: 13.6809 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 496.579 | Positive charged surface: 282.82 | Negative charged surface: 213.759 | Volume: 244.625 |
Hydrophobic surface: 221.423 | Hydrophilic surface: 275.156 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |