Type: Neutral
Formula: C11H13IN4O5
SMILES: |
Ic1c2c(n(c1)C1OC(CO)C(O)C1O)C(=O)NN=C2N |
InChI: |
InChI=1/C11H13IN4O5/c12-3-1-16(6-5(3)9(13)14-15-10(6)20)11-8(19)7(18)4(2-17)21-11/h1,4,7-8,11,17-19H,2H2,(H2,13,14)(H,15,20)/t4-,7+,8+,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 408.152 g/mol | logS: -1.18492 | SlogP: -1.8366 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0973029 | Sterimol/B1: 3.53574 | Sterimol/B2: 4.05464 | Sterimol/B3: 4.5185 |
Sterimol/B4: 5.8422 | Sterimol/L: 13.863 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 501.489 | Positive charged surface: 291.109 | Negative charged surface: 210.38 | Volume: 265.125 |
Hydrophobic surface: 208.077 | Hydrophilic surface: 293.412 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |