Type: Neutral
Formula: C12H18N6O3
SMILES: |
OC1C(O)C(n2c3nc(nc(NC)c3nc2)N)CC1CO |
InChI: |
InChI=1/C12H18N6O3/c1-14-10-7-11(17-12(13)16-10)18(4-15-7)6-2-5(3-19)8(20)9(6)21/h4-6,8-9,19-21H,2-3H2,1H3,(H3,13,14,16,17)/t5-,6+,8-,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 294.315 g/mol | logS: -1.61561 | SlogP: -1.1792 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0817377 | Sterimol/B1: 3.07588 | Sterimol/B2: 3.27753 | Sterimol/B3: 4.12639 |
Sterimol/B4: 5.88936 | Sterimol/L: 15.923 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 518.739 | Positive charged surface: 440.935 | Negative charged surface: 77.8039 | Volume: 261.25 |
Hydrophobic surface: 251.574 | Hydrophilic surface: 267.165 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |