Type: Neutral
Formula: C10H15N3O6
SMILES: |
O1C(CO)C(O)C(O)C1N1C=CC(=NC1=O)NOC |
InChI: |
InChI=1/C10H15N3O6/c1-18-12-6-2-3-13(10(17)11-6)9-8(16)7(15)5(4-14)19-9/h2-3,5,7-9,14-16H,4H2,1H3,(H,11,12,17)/t5-,7+,8-,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 273.245 g/mol | logS: -0.22098 | SlogP: -2.0758 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0626363 | Sterimol/B1: 2.86281 | Sterimol/B2: 4.04875 | Sterimol/B3: 4.39769 |
Sterimol/B4: 4.45647 | Sterimol/L: 14.4663 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 472.38 | Positive charged surface: 342.178 | Negative charged surface: 130.203 | Volume: 228.25 |
Hydrophobic surface: 242.038 | Hydrophilic surface: 230.342 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |