 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C=O)C1C2=C(C(=O)C(O)C3(CC3C)C2=O)C2(C(C1O)C(CCC2)(COC=O)C) C |
| InChI: | InChI=1/C22H28O8/c1-11-7-22(11)18(27)12-13(14(25)19(22)28)21(3)6-4-5-20(2,8-29-9-23)17(21)15(26)16(12)30-10-24/h9-11,15-17,19,26,28H,4-8H2,1-3H3/t11-,15+,16+,17+,19-,20+,21-,22-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=147.32 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 420.458 g/mol | logS: -3.98556 | SlogP: 0.7237 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.170567 | Sterimol/B1: 2.40318 | Sterimol/B2: 4.64596 | Sterimol/B3: 5.59466 | |||
| Sterimol/B4: 6.1303 | Sterimol/L: 15.9679 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 600.876 | Positive charged surface: 389.473 | Negative charged surface: 211.404 | Volume: 379.25 | |||
| Hydrophobic surface: 321.621 | Hydrophilic surface: 279.255 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 8 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.