Type: Neutral
Formula: C11H18N4O7
SMILES: |
O1C(CO)C(O)C(O)C(O)C1NC=1N=C(OC)NC(=O)C=1N |
InChI: |
InChI=1/C11H18N4O7/c1-21-11-14-8(4(12)9(20)15-11)13-10-7(19)6(18)5(17)3(2-16)22-10/h3,5-7,10,16-19H,2,12H2,1H3,(H2,13,14,15,20)/t3-,5+,6+,7+,10-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 318.286 g/mol | logS: 0.01592 | SlogP: -4.3641 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.21151 | Sterimol/B1: 2.48042 | Sterimol/B2: 2.95014 | Sterimol/B3: 5.81959 |
Sterimol/B4: 7.69458 | Sterimol/L: 12.7819 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 516.906 | Positive charged surface: 404.771 | Negative charged surface: 112.135 | Volume: 262.25 |
Hydrophobic surface: 190.117 | Hydrophilic surface: 326.789 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |