Type: Neutral
Formula: C9H11FN2O5
SMILES: |
FC1C(O)C(OC1N1C=CC(=O)NC1=O)CO |
InChI: |
InChI=1/C9H11FN2O5/c10-6-7(15)4(3-13)17-8(6)12-2-1-5(14)11-9(12)16/h1-2,4,6-8,13,15H,3H2,(H,11,14,16)/t4-,6+,7+,8+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 246.194 g/mol | logS: -0.39788 | SlogP: -1.112 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.100956 | Sterimol/B1: 2.54084 | Sterimol/B2: 3.0988 | Sterimol/B3: 3.66765 |
Sterimol/B4: 6.09339 | Sterimol/L: 11.3526 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 402.906 | Positive charged surface: 243.312 | Negative charged surface: 159.594 | Volume: 193.625 |
Hydrophobic surface: 151.293 | Hydrophilic surface: 251.613 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |