 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1CC(NC1C(NC(=O)Cc1ccccc1)C(OCC)=O)C(=O)[O-] |
| InChI: | InChI=1/C16H20N2O5S/c1-2-23-16(22)13(14-17-11(9-24-14)15(20)21)18-12(19)8-10-6-4-3-5-7-10/h3-7,11,13-14,17H,2,8-9H2,1H3,(H,18,19)(H,20,21)/p-1/t11-,13+,14+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=71.0115 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 351.403 g/mol | logS: -3.37254 | SlogP: -0.94203 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0763907 | Sterimol/B1: 2.47068 | Sterimol/B2: 2.58087 | Sterimol/B3: 4.5202 | |||
| Sterimol/B4: 11.1867 | Sterimol/L: 15.0306 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 611.865 | Positive charged surface: 350.761 | Negative charged surface: 261.104 | Volume: 317.5 | |||
| Hydrophobic surface: 401.344 | Hydrophilic surface: 210.521 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
