Type: Neutral
Formula: C21H35NO4
SMILES: |
O1C(CC(CC1=O)CC(=O)NC1CCCCC1)C1CC(CC(C)C1O)C |
InChI: |
InChI=1/C21H35NO4/c1-13-8-14(2)21(25)17(9-13)18-10-15(12-20(24)26-18)11-19(23)22-16-6-4-3-5-7-16/h13-18,21,25H,3-12H2,1-2H3,(H,22,23)/t13-,14+,15+,17-,18-,21-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 365.514 g/mol | logS: -3.69335 | SlogP: 3.1903 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0409408 | Sterimol/B1: 2.2223 | Sterimol/B2: 2.32682 | Sterimol/B3: 4.74116 |
Sterimol/B4: 7.68226 | Sterimol/L: 19.3068 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 650.567 | Positive charged surface: 492.638 | Negative charged surface: 157.929 | Volume: 374 |
Hydrophobic surface: 488.239 | Hydrophilic surface: 162.328 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |