Type: Neutral
Formula: C21H35NO4
SMILES: |
O1C(CC(CC1=O)CC(=O)NC1CCCCC1)C1CC(CC(C)C1O)C |
InChI: |
InChI=1/C21H35NO4/c1-13-8-14(2)21(25)17(9-13)18-10-15(12-20(24)26-18)11-19(23)22-16-6-4-3-5-7-16/h13-18,21,25H,3-12H2,1-2H3,(H,22,23)/t13-,14-,15+,17-,18-,21-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 365.514 g/mol | logS: -3.69335 | SlogP: 3.1903 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0354894 | Sterimol/B1: 2.04541 | Sterimol/B2: 2.1922 | Sterimol/B3: 4.63008 |
Sterimol/B4: 7.51304 | Sterimol/L: 20.0525 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 647.525 | Positive charged surface: 491.148 | Negative charged surface: 156.377 | Volume: 373 |
Hydrophobic surface: 493.243 | Hydrophilic surface: 154.282 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |