 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C(C)(C)C)C(=O)C(NC(=O)C(NC(=O)C1[NH2+]CCC1)Cc1ccccc1)CC(C) C |
| InChI: | InChI=1/C24H37N3O4/c1-16(2)14-20(23(30)31-24(3,4)5)27-22(29)19(15-17-10-7-6-8-11-17)26-21(28)18-12-9-13-25-18/h6-8,10-11,16,18-20,25H,9,12-15H2,1-5H3,(H,26,28)(H,27,29)/p+1/t18-,19-,20-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=80.4782 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 432.585 g/mol | logS: -5.0092 | SlogP: 1.31227 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0791724 | Sterimol/B1: 2.36235 | Sterimol/B2: 2.65502 | Sterimol/B3: 5.4114 | |||
| Sterimol/B4: 10.7763 | Sterimol/L: 17.9942 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 779.854 | Positive charged surface: 565.732 | Negative charged surface: 214.121 | Volume: 454.5 | |||
| Hydrophobic surface: 593.684 | Hydrophilic surface: 186.17 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
