Type: Neutral
Formula: C9H11N2O7PS
SMILES: |
s1cc(nc1C1OC2C(OP(OC2)(O)=O)C1O)C(=O)N |
InChI: |
InChI=1/C9H11N2O7PS/c10-8(13)3-2-20-9(11-3)7-5(12)6-4(17-7)1-16-19(14,15)18-6/h2,4-7,12H,1H2,(H2,10,13)(H,14,15)/t4-,5+,6-,7-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 322.234 g/mol | logS: -0.63293 | SlogP: -1.4161 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0773438 | Sterimol/B1: 2.30172 | Sterimol/B2: 2.77767 | Sterimol/B3: 4.3109 |
Sterimol/B4: 5.16685 | Sterimol/L: 15.505 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 473.147 | Positive charged surface: 265.418 | Negative charged surface: 207.729 | Volume: 232.875 |
Hydrophobic surface: 188.55 | Hydrophilic surface: 284.597 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules
|