Type: Neutral
Formula: C14H18N3O6P
| SMILES: |
P1(OC2CC(OC2CO1)N1C=C(C)C(=O)NC1=O)(=O)C(C#N)(C)C |
| InChI: |
InChI=1/C14H18N3O6P/c1-8-5-17(13(19)16-12(8)18)11-4-9-10(22-11)6-21-24(20,23-9)14(2,3)7-15/h5,9-11H,4,6H2,1-3H3,(H,16,18,19)/t9-,10-,11-,24+/m0/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 355.287 g/mol | logS: -1.89946 | SlogP: 0.397484 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.14724 | Sterimol/B1: 2.07756 | Sterimol/B2: 4.04254 | Sterimol/B3: 4.15104 |
| Sterimol/B4: 6.67555 | Sterimol/L: 14.4501 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 543.456 | Positive charged surface: 326.433 | Negative charged surface: 217.023 | Volume: 298 |
| Hydrophobic surface: 288.056 | Hydrophilic surface: 255.4 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 4 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |