Type: Neutral
Formula: C17H19N2O7P
SMILES: |
P1(OC2CC(OC2CO1)N1C=C(C)C(=O)NC1=O)(OCc1ccccc1)=O |
InChI: |
InChI=1/C17H19N2O7P/c1-11-8-19(17(21)18-16(11)20)15-7-13-14(25-15)10-24-27(22,26-13)23-9-12-5-3-2-4-6-12/h2-6,8,13-15H,7,9-10H2,1H3,(H,18,20,21)/t13-,14-,15+,27-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 394.32 g/mol | logS: -2.89013 | SlogP: 1.4935 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0478698 | Sterimol/B1: 3.08084 | Sterimol/B2: 3.27936 | Sterimol/B3: 4.33138 |
Sterimol/B4: 5.38849 | Sterimol/L: 19.2939 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 618.757 | Positive charged surface: 367.553 | Negative charged surface: 251.204 | Volume: 332 |
Hydrophobic surface: 437.126 | Hydrophilic surface: 181.631 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |