Type: Neutral
Formula: C15H19N3O4S
SMILES: |
s1cccc1CNC1=NC(=O)N(C=C1C)C1OC(CO)C(O)C1 |
InChI: |
InChI=1/C15H19N3O4S/c1-9-7-18(13-5-11(20)12(8-19)22-13)15(21)17-14(9)16-6-10-3-2-4-23-10/h2-4,7,11-13,19-20H,5-6,8H2,1H3,(H,16,17,21)/t11-,12-,13+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 337.4 g/mol | logS: -1.96225 | SlogP: 1.3102 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0552644 | Sterimol/B1: 2.39712 | Sterimol/B2: 3.1974 | Sterimol/B3: 3.86385 |
Sterimol/B4: 6.90882 | Sterimol/L: 17.0166 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 573.628 | Positive charged surface: 352.637 | Negative charged surface: 220.991 | Volume: 299.875 |
Hydrophobic surface: 404.58 | Hydrophilic surface: 169.048 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |