 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OCC(NC(=O)CNC(=O)C([NH3+])C)C(=O)NC(CCC(=O)[O-])C(=O)[O-] |
| InChI: | InChI=1/C13H22N4O8/c1-6(14)11(22)15-4-9(19)16-8(5-18)12(23)17-7(13(24)25)2-3-10(20)21/h6-8,18H,2-5,14H2,1H3,(H,15,22)(H,16,19)(H,17,23)(H,20,21)(H,24,25)/p-1/t6-,7+,8+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=62.0748 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 361.331 g/mol | logS: -0.49616 | SlogP: -7.0251 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0423156 | Sterimol/B1: 2.79127 | Sterimol/B2: 3.46323 | Sterimol/B3: 3.80504 | |||
| Sterimol/B4: 6.22756 | Sterimol/L: 19.6711 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 612.741 | Positive charged surface: 374.044 | Negative charged surface: 238.698 | Volume: 312 | |||
| Hydrophobic surface: 221.286 | Hydrophilic surface: 391.455 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 4 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
