Type: Neutral
Formula: C10H13BrN2O6
SMILES: |
BrC1=CN(C2OC(C)C(O)C(O)C2O)C(=O)NC1=O |
InChI: |
InChI=1/C10H13BrN2O6/c1-3-5(14)6(15)7(16)9(19-3)13-2-4(11)8(17)12-10(13)18/h2-3,5-7,9,14-16H,1H3,(H,12,17,18)/t3-,5+,6+,7+,9-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 337.126 g/mol | logS: -1.35794 | SlogP: -1.2891 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.203171 | Sterimol/B1: 2.35733 | Sterimol/B2: 3.83114 | Sterimol/B3: 4.10559 |
Sterimol/B4: 6.68203 | Sterimol/L: 12.6096 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 464.171 | Positive charged surface: 265.604 | Negative charged surface: 198.567 | Volume: 239.875 |
Hydrophobic surface: 239.862 | Hydrophilic surface: 224.309 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |