 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Clc1cc(ccc1Cl)C(SCC(N)C(O)=O)\C(=C(/O)\CCSCC(N)C(O)=O)\C(=O) C |
| InChI: | InChI=1/C19H24Cl2N2O6S2/c1-9(24)16(15(25)4-5-30-7-13(22)18(26)27)17(31-8-14(23)19(28)29)10-2-3-11(20)12(21)6-10/h2-3,6,13-14,17,25H,4-5,7-8,22-23H2,1H3,(H,26,27)(H,28,29)/b16-15+/t13-,14-,17-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=170.08 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 511.447 g/mol | logS: -4.5953 | SlogP: 3.2114 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.232609 | Sterimol/B1: 3.3275 | Sterimol/B2: 4.78737 | Sterimol/B3: 6.82822 | |||
| Sterimol/B4: 8.872 | Sterimol/L: 16.6101 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 746.944 | Positive charged surface: 390.998 | Negative charged surface: 355.946 | Volume: 423 | |||
| Hydrophobic surface: 356.283 | Hydrophilic surface: 390.661 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 8 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
