Type: Neutral
Formula: C8H14N3O6P
| SMILES: |
P1(=O)(NC(=O)N(C=C1)C1OC(CO)C(O)C1O)N |
| InChI: |
InChI=1/C8H14N3O6P/c9-18(16)2-1-11(8(15)10-18)7-6(14)5(13)4(3-12)17-7/h1-2,4-7,12-14H,3H2,(H3,9,10,15,16)/t4-,5+,6+,7+,18-/m0/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 279.189 g/mol | logS: 1.03935 | SlogP: -2.9966 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.0911218 | Sterimol/B1: 3.1827 | Sterimol/B2: 3.47169 | Sterimol/B3: 4.15577 |
| Sterimol/B4: 5.72992 | Sterimol/L: 12.2012 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 439.09 | Positive charged surface: 284.122 | Negative charged surface: 154.968 | Volume: 214.75 |
| Hydrophobic surface: 122.26 | Hydrophilic surface: 316.83 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 5 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |