Type: Neutral
Formula: C11H14BrN3O5
SMILES: |
BrCC(=O)NCC1OC(N2C=CC(=O)NC2=O)CC1O |
InChI: |
InChI=1/C11H14BrN3O5/c12-4-9(18)13-5-7-6(16)3-10(20-7)15-2-1-8(17)14-11(15)19/h1-2,6-7,10,16H,3-5H2,(H,13,18)(H,14,17,19)/t6-,7-,10-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 348.153 g/mol | logS: -1.7446 | SlogP: -0.9611 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0782137 | Sterimol/B1: 2.43113 | Sterimol/B2: 2.76725 | Sterimol/B3: 3.96908 |
Sterimol/B4: 7.12022 | Sterimol/L: 15.6022 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 518.617 | Positive charged surface: 291.173 | Negative charged surface: 227.443 | Volume: 259 |
Hydrophobic surface: 219.94 | Hydrophilic surface: 298.677 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |