 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C(=O)C1N(CCC1)C(=O)C(NC(OC(C)(C)C)=O)CC(Cc1ccccc1)C(=O)N)C c1ccccc1 |
| InChI: | InChI=1/C29H37N3O6/c1-29(2,3)38-28(36)31-23(18-22(25(30)33)17-20-11-6-4-7-12-20)26(34)32-16-10-15-24(32)27(35)37-19-21-13-8-5-9-14-21/h4-9,11-14,22-24H,10,15-19H2,1-3H3,(H2,30,33)(H,31,36)/t22-,23+,24-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=119.452 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 523.63 g/mol | logS: -5.68277 | SlogP: 3.61477 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.102258 | Sterimol/B1: 3.81617 | Sterimol/B2: 4.68827 | Sterimol/B3: 5.27467 | |||
| Sterimol/B4: 9.25194 | Sterimol/L: 20.0441 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 823.921 | Positive charged surface: 556.064 | Negative charged surface: 267.857 | Volume: 511.125 | |||
| Hydrophobic surface: 635.202 | Hydrophilic surface: 188.719 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.