 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CO)C(O)C(O)C(NC(=O)C([NH3+])C)C1O |
| InChI: | InChI=1/C9H18N2O6/c1-3(10)8(15)11-5-7(14)6(13)4(2-12)17-9(5)16/h3-7,9,12-14,16H,2,10H2,1H3,(H,11,15)/p+1/t3-,4-,5+,6+,7-,9-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=48.8411 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 251.259 g/mol | logS: 0.88066 | SlogP: -4.4671 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.205365 | Sterimol/B1: 2.01284 | Sterimol/B2: 2.97814 | Sterimol/B3: 4.93335 | |||
| Sterimol/B4: 5.60259 | Sterimol/L: 12.823 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 439.76 | Positive charged surface: 334.581 | Negative charged surface: 105.179 | Volume: 219.625 | |||
| Hydrophobic surface: 184.802 | Hydrophilic surface: 254.958 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 6 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
