Type: Neutral
Formula: C11H16N2O5
SMILES: |
OC1C(O)C(N2C=C(C)C(=O)NC2=O)CC1CO |
InChI: |
InChI=1/C11H16N2O5/c1-5-3-13(11(18)12-10(5)17)7-2-6(4-14)8(15)9(7)16/h3,6-9,14-16H,2,4H2,1H3,(H,12,17,18)/t6-,7-,8+,9-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 256.258 g/mol | logS: -0.14333 | SlogP: -1.4554 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.223034 | Sterimol/B1: 2.00174 | Sterimol/B2: 3.79203 | Sterimol/B3: 4.0345 |
Sterimol/B4: 7.0827 | Sterimol/L: 12.1356 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 434.714 | Positive charged surface: 308.571 | Negative charged surface: 126.143 | Volume: 222.25 |
Hydrophobic surface: 209.82 | Hydrophilic surface: 224.894 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |