Type: Neutral
Formula: C10H13FN2O7
SMILES: |
FC1=CN(C2OC(CO)C(O)C(O)C2O)C(=O)NC1=O |
InChI: |
InChI=1/C10H13FN2O7/c11-3-1-13(10(19)12-8(3)18)9-7(17)6(16)5(15)4(2-14)20-9/h1,4-7,9,14-17H,2H2,(H,12,18,19)/t4-,5+,6+,7+,9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 292.219 g/mol | logS: -0.05835 | SlogP: -2.7421 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.125199 | Sterimol/B1: 3.0449 | Sterimol/B2: 3.56694 | Sterimol/B3: 4.07519 |
Sterimol/B4: 5.85711 | Sterimol/L: 12.4329 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 446.934 | Positive charged surface: 290.432 | Negative charged surface: 156.502 | Volume: 222 |
Hydrophobic surface: 177.637 | Hydrophilic surface: 269.297 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |