Type: Neutral
Formula: C16H20N6O4
| SMILES: |
O1C(C2OC(OC2C1n1c2ncnc3N(N=C(N)c(c23)c1)C)(C)C)CO |
| InChI: |
InChI=1/C16H20N6O4/c1-16(2)25-10-8(5-23)24-15(11(10)26-16)22-4-7-9-13(18-6-19-14(9)22)21(3)20-12(7)17/h4,6,8,10-11,15,23H,5H2,1-3H3,(H2,17,20)/t8-,10+,11+,15-/m0/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 360.374 g/mol | logS: -3.43226 | SlogP: 0.0067 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.195489 | Sterimol/B1: 2.28177 | Sterimol/B2: 3.603 | Sterimol/B3: 6.78612 |
| Sterimol/B4: 6.92926 | Sterimol/L: 14.655 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 580.186 | Positive charged surface: 446.877 | Negative charged surface: 127.746 | Volume: 318 |
| Hydrophobic surface: 311.146 | Hydrophilic surface: 269.04 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 4 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |