Type: Neutral
Formula: C11H17BrN2O6
SMILES: |
BrC1(C)C(OC)N(C2OC(CO)C(O)C2)C(=O)NC1=O |
InChI: |
InChI=1/C11H17BrN2O6/c1-11(12)8(17)13-10(18)14(9(11)19-2)7-3-5(16)6(4-15)20-7/h5-7,9,15-16H,3-4H2,1-2H3,(H,13,17,18)/t5-,6-,7-,9-,11+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 353.169 g/mol | logS: -1.4475 | SlogP: -0.4476 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.241636 | Sterimol/B1: 3.04131 | Sterimol/B2: 3.33318 | Sterimol/B3: 5.42404 |
Sterimol/B4: 5.70451 | Sterimol/L: 12.197 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 479.366 | Positive charged surface: 316.345 | Negative charged surface: 163.021 | Volume: 265.625 |
Hydrophobic surface: 221.209 | Hydrophilic surface: 258.157 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |