Type: Neutral
Formula: C12H23NO11
SMILES: |
OC(C(NC(=O)C(O)C(O)C(O)C(O)CO)C=O)C(O)C(O)CO |
InChI: |
InChI=1/C12H23NO11/c14-1-4(7(19)8(20)5(17)2-15)13-12(24)11(23)10(22)9(21)6(18)3-16/h1,4-11,15-23H,2-3H2,(H,13,24)/t4-,5-,6-,7-,8-,9-,10-,11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 357.312 g/mol | logS: 2.0272 | SlogP: -6.819 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0892397 | Sterimol/B1: 2.88205 | Sterimol/B2: 3.23433 | Sterimol/B3: 3.90665 |
Sterimol/B4: 8.57436 | Sterimol/L: 14.1024 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 565.91 | Positive charged surface: 387.022 | Negative charged surface: 178.888 | Volume: 297 |
Hydrophobic surface: 168.186 | Hydrophilic surface: 397.724 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 10 | Hydrogen bond acceptors: 11 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 8 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |