Type: Neutral
Formula: C10H12N4O4S
SMILES: |
S=C1NC=Nc2n(ncc12)C1OC(CO)C(O)C1O |
InChI: |
InChI=1/C10H12N4O4S/c15-2-5-6(16)7(17)10(18-5)14-8-4(1-13-14)9(19)12-3-11-8/h1,3,5-7,10,15-17H,2H2,(H,11,12,19)/t5-,6+,7+,10-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 284.296 g/mol | logS: -1.54691 | SlogP: -1.4714 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.131678 | Sterimol/B1: 2.46925 | Sterimol/B2: 3.84385 | Sterimol/B3: 4.43992 |
Sterimol/B4: 5.90153 | Sterimol/L: 14.0207 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 474.98 | Positive charged surface: 320.49 | Negative charged surface: 154.49 | Volume: 233.125 |
Hydrophobic surface: 183.272 | Hydrophilic surface: 291.708 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |