Type: Neutral
Formula: C14H18N4O6
SMILES: |
O1C(CCC(OCC)=O)C(O)C(O)C1n1c2N=CNC(=O)c2nc1 |
InChI: |
InChI=1/C14H18N4O6/c1-2-23-8(19)4-3-7-10(20)11(21)14(24-7)18-6-17-9-12(18)15-5-16-13(9)22/h5-7,10-11,14,20-21H,2-4H2,1H3,(H,15,16,22)/t7-,10-,11+,14-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 338.32 g/mol | logS: -1.63634 | SlogP: -0.6557 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0489915 | Sterimol/B1: 2.91799 | Sterimol/B2: 3.09346 | Sterimol/B3: 3.81912 |
Sterimol/B4: 7.44945 | Sterimol/L: 18.2864 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 584.581 | Positive charged surface: 422.587 | Negative charged surface: 161.994 | Volume: 295.5 |
Hydrophobic surface: 294.433 | Hydrophilic surface: 290.148 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |