Type: Neutral
Formula: C15H16N2O6
SMILES: |
O1C(CO)C(O)CC1N1C=C(Oc2ccccc2)C(=O)NC1=O |
InChI: |
InChI=1/C15H16N2O6/c18-8-12-10(19)6-13(23-12)17-7-11(14(20)16-15(17)21)22-9-4-2-1-3-5-9/h1-5,7,10,12-13,18-19H,6,8H2,(H,16,20,21)/t10-,12+,13-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 320.301 g/mol | logS: -2.0947 | SlogP: -0.0732 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.080997 | Sterimol/B1: 3.03221 | Sterimol/B2: 3.67723 | Sterimol/B3: 4.69809 |
Sterimol/B4: 5.17285 | Sterimol/L: 15.7961 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 532.416 | Positive charged surface: 337.751 | Negative charged surface: 194.664 | Volume: 278.625 |
Hydrophobic surface: 332.939 | Hydrophilic surface: 199.477 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |