Type: Neutral
Formula: C19H22N2O6
SMILES: |
O=C1NC(=O)C=C2N(c3cc(C)c(cc3C=C12)C)CC(O)C(O)C(O)CO |
InChI: |
InChI=1/C19H22N2O6/c1-9-3-11-5-12-14(6-17(25)20-19(12)27)21(13(11)4-10(9)2)7-15(23)18(26)16(24)8-22/h3-6,15-16,18,22-24,26H,7-8H2,1-2H3,(H,20,25,27)/t15-,16-,18-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 374.393 g/mol | logS: -3.36787 | SlogP: -0.87786 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0603667 | Sterimol/B1: 2.95885 | Sterimol/B2: 3.23036 | Sterimol/B3: 3.64654 |
Sterimol/B4: 9.48554 | Sterimol/L: 15.3172 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 582.976 | Positive charged surface: 356.717 | Negative charged surface: 226.26 | Volume: 336 |
Hydrophobic surface: 321.042 | Hydrophilic surface: 261.934 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |