Type: Neutral
Formula: C13H15ClN4O5
SMILES: |
Clc1nc(nc2[nH]ccc12)N(C(=O)C)C1OC(CO)C(O)C1O |
InChI: |
InChI=1/C13H15ClN4O5/c1-5(20)18(12-9(22)8(21)7(4-19)23-12)13-16-10(14)6-2-3-15-11(6)17-13/h2-3,7-9,12,19,21-22H,4H2,1H3,(H,15,16,17)/t7-,8+,9-,12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 342.739 g/mol | logS: -3.13004 | SlogP: -0.5968 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0698029 | Sterimol/B1: 2.50964 | Sterimol/B2: 2.92721 | Sterimol/B3: 3.91137 |
Sterimol/B4: 8.62815 | Sterimol/L: 13.4034 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 513.224 | Positive charged surface: 324.904 | Negative charged surface: 183.227 | Volume: 280.125 |
Hydrophobic surface: 287.198 | Hydrophilic surface: 226.026 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |