Type: Neutral
Formula: C11H17FN2O6S
SMILES: |
S(C(N1C=C(F)C(=O)NC1=O)C(O)C(O)C(O)CO)CC |
InChI: |
InChI=1/C11H17FN2O6S/c1-2-21-10(8(18)7(17)6(16)4-15)14-3-5(12)9(19)13-11(14)20/h3,6-8,10,15-18H,2,4H2,1H3,(H,13,19,20)/t6-,7-,8+,10-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 324.329 g/mol | logS: -1.08596 | SlogP: -1.3878 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.149222 | Sterimol/B1: 2.27889 | Sterimol/B2: 3.90789 | Sterimol/B3: 4.18317 |
Sterimol/B4: 8.4768 | Sterimol/L: 14.7178 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 508.872 | Positive charged surface: 316.201 | Negative charged surface: 192.672 | Volume: 264.25 |
Hydrophobic surface: 226.82 | Hydrophilic surface: 282.052 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |