Type: Ionized
Formula: C4H7NO8S2-2
SMILES: |
S(=O)(=O)([O-])C(S(=O)(=O)[O-])NC(OCC)=O |
InChI: |
InChI=1/C4H9NO8S2/c1-2-13-3(6)5-4(14(7,8)9)15(10,11)12/h4H,2H2,1H3,(H,5,6)(H,7,8,9)(H,10,11,12)/p-2 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 261.231 g/mol | logS: 0.21223 | SlogP: -1.8935 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0987881 | Sterimol/B1: 3.12541 | Sterimol/B2: 3.87302 | Sterimol/B3: 3.99372 |
Sterimol/B4: 4.52748 | Sterimol/L: 12.6395 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 403.148 | Positive charged surface: 151.44 | Negative charged surface: 251.708 | Volume: 171.875 |
Hydrophobic surface: 117.395 | Hydrophilic surface: 285.753 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 6 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|