 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CO)C(O)C(O)C1N1C=CC(=NC1=O)NC(=O)CCC |
| InChI: | InChI=1/C13H19N3O6/c1-2-3-9(18)14-8-4-5-16(13(21)15-8)12-11(20)10(19)7(6-17)22-12/h4-5,7,10-12,17,19-20H,2-3,6H2,1H3,(H,14,15,18,21)/t7-,10+,11-,12-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=69.3616 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 313.31 g/mol | logS: -1.07808 | SlogP: -1.3105 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0301166 | Sterimol/B1: 3.3428 | Sterimol/B2: 3.63987 | Sterimol/B3: 4.44831 | |||
| Sterimol/B4: 4.57162 | Sterimol/L: 17.6835 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 551.451 | Positive charged surface: 391.267 | Negative charged surface: 160.184 | Volume: 275.375 | |||
| Hydrophobic surface: 292.835 | Hydrophilic surface: 258.616 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.