Type: Neutral
Formula: C10H18N4O6S2
SMILES: |
S(SCC(NC(=O)CN)C(O)=O)CC(NC(=O)CN)C(O)=O |
InChI: |
InChI=1/C10H18N4O6S2/c11-1-7(15)13-5(9(17)18)3-21-22-4-6(10(19)20)14-8(16)2-12/h5-6H,1-4,11-12H2,(H,13,15)(H,14,16)(H,17,18)(H,19,20)/t5-,6-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 354.408 g/mol | logS: -1.40576 | SlogP: -2.576 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0508973 | Sterimol/B1: 2.48465 | Sterimol/B2: 3.8131 | Sterimol/B3: 4.17968 |
Sterimol/B4: 6.57816 | Sterimol/L: 15.0505 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 598.542 | Positive charged surface: 385.129 | Negative charged surface: 213.414 | Volume: 293.625 |
Hydrophobic surface: 162.582 | Hydrophilic surface: 435.96 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 8 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |