 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CCN(CC1)CCCCC(C(CC)C)(CNC(=O)CN(CC)CC)c1c2c(ccc1)cccc2 |
| InChI: | InChI=1/C30H47N3O2/c1-5-25(4)30(24-31-29(34)23-32(6-2)7-3,17-10-11-18-33-19-21-35-22-20-33)28-16-12-14-26-13-8-9-15-27(26)28/h8-9,12-16,25H,5-7,10-11,17-24H2,1-4H3,(H,31,34)/t25-,30+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=221.494 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 481.725 g/mol | logS: -6.43934 | SlogP: 5.0842 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.106431 | Sterimol/B1: 2.21986 | Sterimol/B2: 4.84085 | Sterimol/B3: 5.83834 | |||
| Sterimol/B4: 11.486 | Sterimol/L: 20.7591 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 842.768 | Positive charged surface: 628.398 | Negative charged surface: 209.762 | Volume: 512.875 | |||
| Hydrophobic surface: 729.786 | Hydrophilic surface: 112.982 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
